C13H18ClNO3S — CID 43615551
2-chloro-1-[1-(1,1-dioxothian-4-yl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 43615551) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is 2-chloro-1-[1-(1,1-dioxothian-4-yl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-chloro-1-[1-(1,1-dioxothian-4-yl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 43615551 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-chloro-1-[1-(1,1-dioxothian-4-yl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | Cc1cc(C(=O)CCl)c(C)n1C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H18ClNO3S/c1-9-7-12(13(16)8-14)10(2)15(9)11-3-5-19(17,18)6-4-11/h7,11H,3-6,8H2,1-2H3 |
| InChIKey | KGDRFMZLQJFOQI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|