C17H22N2O7 — CID 10618885
[(2R,3S)-3-acetyloxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-prop-2-enyloxolan-2-yl]methyl acetate (PubChem CID 10618885) has the molecular formula C17H22N2O7 and a molecular weight of 366.37 g/mol. Its IUPAC name is [(2R,3S)-3-acetyloxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-prop-2-enyloxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S)-3-acetyloxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-prop-2-enyloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10618885 |
| Molecular Formula | C17H22N2O7 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | [(2R,3S)-3-acetyloxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-prop-2-enyloxolan-2-yl]methyl acetate |
| SMILES | C=CC[C@]1(OC(C)=O)CC(n2cc(C)c(=O)[nH]c2=O)O[C@@H]1COC(C)=O |
| InChI | InChI=1S/C17H22N2O7/c1-5-6-17(26-12(4)21)7-14(25-13(17)9-24-11(3)20)19-8-10(2)15(22)18-16(19)23/h5,8,13-14H,1,6-7,9H2,2-4H3,(H,18,22,23)/t13-,14?,17+/m1/s1 |
| InChIKey | DRPHFRPGTDIYED-HFIQTRLSSA-N |
| XLogP | 0.57 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|