C12H17N2O8P — CID 175935384
[(2R,3R,5R)-3-ethenyl-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 175935384) has the molecular formula C12H17N2O8P and a molecular weight of 348.25 g/mol. Its IUPAC name is [(2R,3R,5R)-3-ethenyl-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,5R)-3-ethenyl-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 175935384 |
| Molecular Formula | C12H17N2O8P |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | [(2R,3R,5R)-3-ethenyl-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | C=C[C@]1(O)C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1COP(=O)(O)O |
| InChI | InChI=1S/C12H17N2O8P/c1-3-12(17)4-9(22-8(12)6-21-23(18,19)20)14-5-7(2)10(15)13-11(14)16/h3,5,8-9,17H,1,4,6H2,2H3,(H,13,15,16)(H2,18,19,20)/t8-,9-,12+/m1/s1 |
| InChIKey | WGOZSKVMFXGVSW-LNLATYFQSA-N |
| XLogP | -0.84 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|