C21H24N2O2S — CID 10619049
methyl (1S,12R,19R)-12-ethyl-15-sulfanylidene-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,9-tetraene-10-carboxylate (PubChem CID 10619049) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is methyl (1S,12R,19R)-12-ethyl-15-sulfanylidene-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,9-tetraene-10-carboxylate.
| Compound Name | methyl (1S,12R,19R)-12-ethyl-15-sulfanylidene-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,9-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 10619049 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | methyl (1S,12R,19R)-12-ethyl-15-sulfanylidene-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,9-tetraene-10-carboxylate |
| SMILES | CC[C@@]12CCC(=S)N3CC[C@@]4(C(=C(C(=O)OC)C1)Nc1ccccc14)[C@H]32 |
| InChI | InChI=1S/C21H24N2O2S/c1-3-20-9-8-16(26)23-11-10-21(19(20)23)14-6-4-5-7-15(14)22-17(21)13(12-20)18(24)25-2/h4-7,19,22H,3,8-12H2,1-2H3/t19-,20-,21-/m1/s1 |
| InChIKey | DJTZPINZTWICAF-NJDAHSKKSA-N |
| XLogP | 3.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|