C24H26N2O4 — CID 11395645
methyl (1R,12R,13S,23S)-12-ethyl-19-oxo-16-oxa-8,20-diazahexacyclo[10.10.1.01,9.02,7.013,18.020,23]tricosa-2,4,6,9,17-pentaene-10-carboxylate (PubChem CID 11395645) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is methyl (1R,12R,13S,23S)-12-ethyl-19-oxo-16-oxa-8,20-diazahexacyclo[10.10.1.01,9.02,7.013,18.020,23]tricosa-2,4,6,9,17-pentaene-10-carboxylate.
| Compound Name | methyl (1R,12R,13S,23S)-12-ethyl-19-oxo-16-oxa-8,20-diazahexacyclo[10.10.1.01,9.02,7.013,18.020,23]tricosa-2,4,6,9,17-pentaene-10-carboxylate |
|---|---|
| PubChem CID | 11395645 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | methyl (1R,12R,13S,23S)-12-ethyl-19-oxo-16-oxa-8,20-diazahexacyclo[10.10.1.01,9.02,7.013,18.020,23]tricosa-2,4,6,9,17-pentaene-10-carboxylate |
| SMILES | CC[C@@]12CC(C(=O)OC)=C3Nc4ccccc4[C@@]34CCN(C(=O)C3=COCC[C@H]31)[C@@H]24 |
| InChI | InChI=1S/C24H26N2O4/c1-3-23-12-14(21(28)29-2)19-24(17-6-4-5-7-18(17)25-19)9-10-26(22(23)24)20(27)15-13-30-11-8-16(15)23/h4-7,13,16,22,25H,3,8-12H2,1-2H3/t16-,22+,23-,24+/m1/s1 |
| InChIKey | NERGOHZRCDNVTP-YVGVGRQMSA-N |
| XLogP | 3.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |