C21H24N2O4 — CID 132566485
methyl (1R,12R,16R,17R,22R)-17-hydroxy-15-oxa-8,19-diazahexacyclo[10.9.1.01,9.02,7.012,16.019,22]docosa-2,4,6,9-tetraene-10-carboxylate (PubChem CID 132566485) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl (1R,12R,16R,17R,22R)-17-hydroxy-15-oxa-8,19-diazahexacyclo[10.9.1.01,9.02,7.012,16.019,22]docosa-2,4,6,9-tetraene-10-carboxylate.
| Compound Name | methyl (1R,12R,16R,17R,22R)-17-hydroxy-15-oxa-8,19-diazahexacyclo[10.9.1.01,9.02,7.012,16.019,22]docosa-2,4,6,9-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 132566485 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | methyl (1R,12R,16R,17R,22R)-17-hydroxy-15-oxa-8,19-diazahexacyclo[10.9.1.01,9.02,7.012,16.019,22]docosa-2,4,6,9-tetraene-10-carboxylate |
| SMILES | COC(=O)C1=C2Nc3ccccc3[C@@]23CCN2C[C@@H](O)[C@@H]4OCC[C@]4(C1)[C@H]23 |
| InChI | InChI=1S/C21H24N2O4/c1-26-18(25)12-10-20-7-9-27-17(20)15(24)11-23-8-6-21(19(20)23)13-4-2-3-5-14(13)22-16(12)21/h2-5,15,17,19,22,24H,6-11H2,1H3/t15-,17+,19+,20-,21+/m1/s1 |
| InChIKey | LDBTVWASVPVRBM-CBISJHAASA-N |
| XLogP | 1.40 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |