C24H35NO2 — CID 10619109
(3E)-9-[3-[(2-methylpropan-2-yl)oxy]propyl]-3-(2-methylpropylidene)-1,2,5,6,7,8-hexahydroacridin-4-one (PubChem CID 10619109) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is (3E)-9-[3-[(2-methylpropan-2-yl)oxy]propyl]-3-(2-methylpropylidene)-1,2,5,6,7,8-hexahydroacridin-4-one.
| Compound Name | (3E)-9-[3-[(2-methylpropan-2-yl)oxy]propyl]-3-(2-methylpropylidene)-1,2,5,6,7,8-hexahydroacridin-4-one |
|---|---|
| PubChem CID | 10619109 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | (3E)-9-[3-[(2-methylpropan-2-yl)oxy]propyl]-3-(2-methylpropylidene)-1,2,5,6,7,8-hexahydroacridin-4-one |
| SMILES | CC(C)/C=C1\CCc2c(nc3c(c2CCCOC(C)(C)C)CCCC3)C1=O |
| InChI | InChI=1S/C24H35NO2/c1-16(2)15-17-12-13-20-18(10-8-14-27-24(3,4)5)19-9-6-7-11-21(19)25-22(20)23(17)26/h15-16H,6-14H2,1-5H3/b17-15+ |
| InChIKey | IFMYXDATFSTEQJ-BMRADRMJSA-N |
| XLogP | 5.42 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|