C20H31NO2 — CID 10041540
9-[3-[(2-methylpropan-2-yl)oxy]propyl]-1,2,3,4,5,6,7,8-octahydroacridin-4-ol (PubChem CID 10041540) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 9-[3-[(2-methylpropan-2-yl)oxy]propyl]-1,2,3,4,5,6,7,8-octahydroacridin-4-ol.
| Compound Name | 9-[3-[(2-methylpropan-2-yl)oxy]propyl]-1,2,3,4,5,6,7,8-octahydroacridin-4-ol |
|---|---|
| PubChem CID | 10041540 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 9-[3-[(2-methylpropan-2-yl)oxy]propyl]-1,2,3,4,5,6,7,8-octahydroacridin-4-ol |
| SMILES | CC(C)(C)OCCCc1c2c(nc3c1CCCC3O)CCCC2 |
| InChI | InChI=1S/C20H31NO2/c1-20(2,3)23-13-7-10-14-15-8-4-5-11-17(15)21-19-16(14)9-6-12-18(19)22/h18,22H,4-13H2,1-3H3 |
| InChIKey | IDCQCVKYCJIKMU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|