C11H17NOS — CID 79413051
2-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol (PubChem CID 79413051) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is 2-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol.
| Compound Name | 2-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol |
|---|---|
| PubChem CID | 79413051 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol |
| SMILES | CCCCc1nc2c(s1)CCCC2O |
| InChI | InChI=1S/C11H17NOS/c1-2-3-7-10-12-11-8(13)5-4-6-9(11)14-10/h8,13H,2-7H2,1H3 |
| InChIKey | PFJQCKWFZVBXLK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |