C18H27BrO3 — CID 10619202
(E)-6-bromo-1-[5-(1,3-dioxolan-2-yl)-2,6,6-trimethylcyclohexen-1-yl]hex-2-en-1-one (PubChem CID 10619202) has the molecular formula C18H27BrO3 and a molecular weight of 371.32 g/mol. Its IUPAC name is (E)-6-bromo-1-[5-(1,3-dioxolan-2-yl)-2,6,6-trimethylcyclohexen-1-yl]hex-2-en-1-one.
| Compound Name | (E)-6-bromo-1-[5-(1,3-dioxolan-2-yl)-2,6,6-trimethylcyclohexen-1-yl]hex-2-en-1-one |
|---|---|
| PubChem CID | 10619202 |
| Molecular Formula | C18H27BrO3 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (E)-6-bromo-1-[5-(1,3-dioxolan-2-yl)-2,6,6-trimethylcyclohexen-1-yl]hex-2-en-1-one |
| SMILES | CC1=C(C(=O)/C=C/CCCBr)C(C)(C)C(C2OCCO2)CC1 |
| InChI | InChI=1S/C18H27BrO3/c1-13-8-9-14(17-21-11-12-22-17)18(2,3)16(13)15(20)7-5-4-6-10-19/h5,7,14,17H,4,6,8-12H2,1-3H3/b7-5+ |
| InChIKey | GUKZRXHDOPIDDD-FNORWQNLSA-N |
| XLogP | 4.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|