C20H28Cl2O2 — CID 10619206
(1S,11R,12S,15S,16S)-5,5-dichloro-6-methoxy-16-methylpentacyclo[9.7.0.02,8.04,6.012,16]octadec-2(8)-en-15-ol (PubChem CID 10619206) has the molecular formula C20H28Cl2O2 and a molecular weight of 371.35 g/mol. Its IUPAC name is (1S,11R,12S,15S,16S)-5,5-dichloro-6-methoxy-16-methylpentacyclo[9.7.0.02,8.04,6.012,16]octadec-2(8)-en-15-ol.
| Compound Name | (1S,11R,12S,15S,16S)-5,5-dichloro-6-methoxy-16-methylpentacyclo[9.7.0.02,8.04,6.012,16]octadec-2(8)-en-15-ol |
|---|---|
| PubChem CID | 10619206 |
| Molecular Formula | C20H28Cl2O2 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (1S,11R,12S,15S,16S)-5,5-dichloro-6-methoxy-16-methylpentacyclo[9.7.0.02,8.04,6.012,16]octadec-2(8)-en-15-ol |
| SMILES | COC12CC3=C(CC1C2(Cl)Cl)[C@H]1CC[C@]2(C)[C@@H](O)CC[C@H]2[C@@H]1CC3 |
| InChI | InChI=1S/C20H28Cl2O2/c1-18-8-7-12-13(15(18)5-6-17(18)23)4-3-11-10-19(24-2)16(9-14(11)12)20(19,21)22/h12-13,15-17,23H,3-10H2,1-2H3/t12-,13+,15-,16?,17-,18-,19?/m0/s1 |
| InChIKey | XNOIWKJGXQAQAT-WFDSCVJOSA-N |
| XLogP | 4.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|