C14H13ClN4O2 — CID 106193036
N-benzyl-2-[(6-chloro-5-formylpyrimidin-4-yl)amino]acetamide (PubChem CID 106193036) has the molecular formula C14H13ClN4O2 and a molecular weight of 304.74 g/mol. Its IUPAC name is N-benzyl-2-[(6-chloro-5-formylpyrimidin-4-yl)amino]acetamide.
| Compound Name | N-benzyl-2-[(6-chloro-5-formylpyrimidin-4-yl)amino]acetamide |
|---|---|
| PubChem CID | 106193036 |
| Molecular Formula | C14H13ClN4O2 |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-benzyl-2-[(6-chloro-5-formylpyrimidin-4-yl)amino]acetamide |
| SMILES | O=Cc1c(Cl)ncnc1NCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C14H13ClN4O2/c15-13-11(8-20)14(19-9-18-13)17-7-12(21)16-6-10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H,16,21)(H,17,18,19) |
| InChIKey | DUMQGPWZZQQYSI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|