C11H11ClN4OS — CID 106193043
N-benzyl-2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]acetamide (PubChem CID 106193043) has the molecular formula C11H11ClN4OS and a molecular weight of 282.76 g/mol. Its IUPAC name is N-benzyl-2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]acetamide.
| Compound Name | N-benzyl-2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]acetamide |
|---|---|
| PubChem CID | 106193043 |
| Molecular Formula | C11H11ClN4OS |
| Molecular Weight | 282.76 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | N-benzyl-2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]acetamide |
| SMILES | O=C(CNc1nsnc1Cl)NCc1ccccc1 |
| InChI | InChI=1S/C11H11ClN4OS/c12-10-11(16-18-15-10)14-7-9(17)13-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,13,17)(H,14,16) |
| InChIKey | ICQMTVCRPSLOCX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.76 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |