C14H16ClN3S — CID 106193058
3-chloro-5,6-dimethyl-N-(2-phenylsulfanylethyl)pyrazin-2-amine (PubChem CID 106193058) has the molecular formula C14H16ClN3S and a molecular weight of 293.82 g/mol. Its IUPAC name is 3-chloro-5,6-dimethyl-N-(2-phenylsulfanylethyl)pyrazin-2-amine.
| Compound Name | 3-chloro-5,6-dimethyl-N-(2-phenylsulfanylethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 106193058 |
| Molecular Formula | C14H16ClN3S |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-chloro-5,6-dimethyl-N-(2-phenylsulfanylethyl)pyrazin-2-amine |
| SMILES | Cc1nc(Cl)c(NCCSc2ccccc2)nc1C |
| InChI | InChI=1S/C14H16ClN3S/c1-10-11(2)18-14(13(15)17-10)16-8-9-19-12-6-4-3-5-7-12/h3-7H,8-9H2,1-2H3,(H,16,18) |
| InChIKey | XXZAQGQOVKHOSM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|