C11H9ClN6 — CID 106193133
4-chloro-N-(1H-1,2,4-triazol-5-ylmethyl)phthalazin-1-amine (PubChem CID 106193133) has the molecular formula C11H9ClN6 and a molecular weight of 260.69 g/mol. Its IUPAC name is 4-chloro-N-(1H-1,2,4-triazol-5-ylmethyl)phthalazin-1-amine.
| Compound Name | 4-chloro-N-(1H-1,2,4-triazol-5-ylmethyl)phthalazin-1-amine |
|---|---|
| PubChem CID | 106193133 |
| Molecular Formula | C11H9ClN6 |
| Molecular Weight | 260.69 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 4-chloro-N-(1H-1,2,4-triazol-5-ylmethyl)phthalazin-1-amine |
| SMILES | Clc1nnc(NCc2ncn[nH]2)c2ccccc12 |
| InChI | InChI=1S/C11H9ClN6/c12-10-7-3-1-2-4-8(7)11(18-17-10)13-5-9-14-6-15-16-9/h1-4,6H,5H2,(H,13,18)(H,14,15,16) |
| InChIKey | OZLQOLLMZQBCME-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.69 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |