About 2-cyclopropylethyl 2-amino-5-methoxypentanoate
2-cyclopropylethyl 2-amino-5-methoxypentanoate (PubChem CID 106202545) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is 2-cyclopropylethyl 2-amino-5-methoxypentanoate.
Molecular Properties
| Compound Name | 2-cyclopropylethyl 2-amino-5-methoxypentanoate |
| PubChem CID | 106202545 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 2-cyclopropylethyl 2-amino-5-methoxypentanoate |
| SMILES | COCCCC(N)C(=O)OCCC1CC1 |
| InChI | InChI=1S/C11H21NO3/c1-14-7-2-3-10(12)11(13)15-8-6-9-4-5-9/h9-10H,2-8,12H2,1H3 |
| InChIKey | HDMBSQXXOFYSSG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropylethyl 2-amino-5-methoxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylethyl 2-amino-5-methoxypentanoate?
The IUPAC name of 2-cyclopropylethyl 2-amino-5-methoxypentanoate (CID 106202545) is 2-cyclopropylethyl 2-amino-5-methoxypentanoate.
What is the SMILES notation for 2-cyclopropylethyl 2-amino-5-methoxypentanoate?
The canonical SMILES for 2-cyclopropylethyl 2-amino-5-methoxypentanoate is COCCCC(N)C(=O)OCCC1CC1.
What is the InChIKey of 2-cyclopropylethyl 2-amino-5-methoxypentanoate?
The InChIKey is HDMBSQXXOFYSSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-14-7-2-3-10(12)11(13)15-8-6-9-4-5-9/h9-10H,2-8,12H2,1H3.
What are the key properties of 2-cyclopropylethyl 2-amino-5-methoxypentanoate?
2-cyclopropylethyl 2-amino-5-methoxypentanoate has a molecular weight of 215.29 g/mol, XLogP of 1.08, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylethyl 2-amino-5-methoxypentanoate is sourced from PubChem (CID 106202545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).