C24H28N4O — CID 10620326
(E)-1-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidin-1-yl]-3-phenylpent-2-en-1-one (PubChem CID 10620326) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is (E)-1-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidin-1-yl]-3-phenylpent-2-en-1-one.
| Compound Name | (E)-1-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidin-1-yl]-3-phenylpent-2-en-1-one |
|---|---|
| PubChem CID | 10620326 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | (E)-1-[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidin-1-yl]-3-phenylpent-2-en-1-one |
| SMILES | CC/C(=C\C(=O)N1CCC(Cn2c(C)nc3cnccc32)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H28N4O/c1-3-20(21-7-5-4-6-8-21)15-24(29)27-13-10-19(11-14-27)17-28-18(2)26-22-16-25-12-9-23(22)28/h4-9,12,15-16,19H,3,10-11,13-14,17H2,1-2H3/b20-15+ |
| InChIKey | NOTKEUOJAXVFSD-HMMYKYKNSA-N |
| XLogP | 4.47 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|