C23H38O5 — CID 10620668
2-[(3S,6R)-6-[(E)-hexadec-6-en-4-ynyl]-6-methoxydioxan-3-yl]acetic acid (PubChem CID 10620668) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is 2-[(3S,6R)-6-[(E)-hexadec-6-en-4-ynyl]-6-methoxydioxan-3-yl]acetic acid.
| Compound Name | 2-[(3S,6R)-6-[(E)-hexadec-6-en-4-ynyl]-6-methoxydioxan-3-yl]acetic acid |
|---|---|
| PubChem CID | 10620668 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 2-[(3S,6R)-6-[(E)-hexadec-6-en-4-ynyl]-6-methoxydioxan-3-yl]acetic acid |
| SMILES | CCCCCCCCC/C=C/C#CCCC[C@]1(OC)CC[C@@H](CC(=O)O)OO1 |
| InChI | InChI=1S/C23H38O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-23(26-2)19-17-21(27-28-23)20-22(24)25/h11-12,21H,3-10,15-20H2,1-2H3,(H,24,25)/b12-11+/t21-,23+/m0/s1 |
| InChIKey | YLKDYIIQSISYAD-OQMUJVAMSA-N |
| XLogP | 5.78 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|