C20H28O8 — CID 10620757
[(5R,6E,13S,14E)-13-acetyloxy-2,10-dimethyl-8,16-dioxo-1,9-dioxacyclohexadeca-6,14-dien-5-yl] acetate (PubChem CID 10620757) has the molecular formula C20H28O8 and a molecular weight of 396.44 g/mol. Its IUPAC name is [(5R,6E,13S,14E)-13-acetyloxy-2,10-dimethyl-8,16-dioxo-1,9-dioxacyclohexadeca-6,14-dien-5-yl] acetate.
| Compound Name | [(5R,6E,13S,14E)-13-acetyloxy-2,10-dimethyl-8,16-dioxo-1,9-dioxacyclohexadeca-6,14-dien-5-yl] acetate |
|---|---|
| PubChem CID | 10620757 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | [(5R,6E,13S,14E)-13-acetyloxy-2,10-dimethyl-8,16-dioxo-1,9-dioxacyclohexadeca-6,14-dien-5-yl] acetate |
| SMILES | CC(=O)O[C@@H]1/C=C/C(=O)OC(C)CC[C@@H](OC(C)=O)/C=C/C(=O)OC(C)CC1 |
| InChI | InChI=1S/C20H28O8/c1-13-5-7-17(27-15(3)21)10-12-20(24)26-14(2)6-8-18(28-16(4)22)9-11-19(23)25-13/h9-14,17-18H,5-8H2,1-4H3/b11-9+,12-10+/t13?,14?,17-,18+ |
| InChIKey | VIBSYUHFRJIKCB-AWKDUDCYSA-N |
| XLogP | 2.40 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|