C10H17N3OS — CID 106209325
1-oxo-N-[1-(1H-pyrazol-4-yl)ethyl]thian-4-amine (PubChem CID 106209325) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 1-oxo-N-[1-(1H-pyrazol-4-yl)ethyl]thian-4-amine.
| Compound Name | 1-oxo-N-[1-(1H-pyrazol-4-yl)ethyl]thian-4-amine |
|---|---|
| PubChem CID | 106209325 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1-oxo-N-[1-(1H-pyrazol-4-yl)ethyl]thian-4-amine |
| SMILES | CC(NC1CCS(=O)CC1)c1cn[nH]c1 |
| InChI | InChI=1S/C10H17N3OS/c1-8(9-6-11-12-7-9)13-10-2-4-15(14)5-3-10/h6-8,10,13H,2-5H2,1H3,(H,11,12) |
| InChIKey | UWHHIMWKWXXFPT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |