C13H23N3 — CID 103922095
3,3-dimethyl-N-[1-(1H-pyrazol-4-yl)ethyl]cyclohexan-1-amine (PubChem CID 103922095) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 3,3-dimethyl-N-[1-(1H-pyrazol-4-yl)ethyl]cyclohexan-1-amine.
| Compound Name | 3,3-dimethyl-N-[1-(1H-pyrazol-4-yl)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 103922095 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 3,3-dimethyl-N-[1-(1H-pyrazol-4-yl)ethyl]cyclohexan-1-amine |
| SMILES | CC(NC1CCCC(C)(C)C1)c1cn[nH]c1 |
| InChI | InChI=1S/C13H23N3/c1-10(11-8-14-15-9-11)16-12-5-4-6-13(2,3)7-12/h8-10,12,16H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | SXGKAAGVMHKQOO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |