C9H14F3N — CID 106210350
N-(1-cyclopropylethyl)-1-(trifluoromethyl)cyclopropan-1-amine (PubChem CID 106210350) has the molecular formula C9H14F3N and a molecular weight of 193.21 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-1-(trifluoromethyl)cyclopropan-1-amine.
| Compound Name | N-(1-cyclopropylethyl)-1-(trifluoromethyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 106210350 |
| Molecular Formula | C9H14F3N |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-(1-cyclopropylethyl)-1-(trifluoromethyl)cyclopropan-1-amine |
| SMILES | CC(NC1(C(F)(F)F)CC1)C1CC1 |
| InChI | InChI=1S/C9H14F3N/c1-6(7-2-3-7)13-8(4-5-8)9(10,11)12/h6-7,13H,2-5H2,1H3 |
| InChIKey | KKJVJVDDUHMDNC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |