C8H12F3N3O2 — CID 106212536
N-carbamoyl-2-[[1-(trifluoromethyl)cyclopropyl]amino]propanamide (PubChem CID 106212536) has the molecular formula C8H12F3N3O2 and a molecular weight of 239.20 g/mol. Its IUPAC name is N-carbamoyl-2-[[1-(trifluoromethyl)cyclopropyl]amino]propanamide.
| Compound Name | N-carbamoyl-2-[[1-(trifluoromethyl)cyclopropyl]amino]propanamide |
|---|---|
| PubChem CID | 106212536 |
| Molecular Formula | C8H12F3N3O2 |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | N-carbamoyl-2-[[1-(trifluoromethyl)cyclopropyl]amino]propanamide |
| SMILES | CC(NC1(C(F)(F)F)CC1)C(=O)NC(N)=O |
| InChI | InChI=1S/C8H12F3N3O2/c1-4(5(15)13-6(12)16)14-7(2-3-7)8(9,10)11/h4,14H,2-3H2,1H3,(H3,12,13,15,16) |
| InChIKey | XMYUEVLGPSZYNT-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |