C8H10F3NO3 — CID 106216719
2-methyl-3-oxo-3-[[1-(trifluoromethyl)cyclopropyl]amino]propanoic acid (PubChem CID 106216719) has the molecular formula C8H10F3NO3 and a molecular weight of 225.17 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-[[1-(trifluoromethyl)cyclopropyl]amino]propanoic acid.
| Compound Name | 2-methyl-3-oxo-3-[[1-(trifluoromethyl)cyclopropyl]amino]propanoic acid |
|---|---|
| PubChem CID | 106216719 |
| Molecular Formula | C8H10F3NO3 |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 2-methyl-3-oxo-3-[[1-(trifluoromethyl)cyclopropyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)C(=O)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H10F3NO3/c1-4(6(14)15)5(13)12-7(2-3-7)8(9,10)11/h4H,2-3H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | ZMUVRWTUQLSVLX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|