C9H14F3NO — CID 176873148
3-methyl-N-[1-(trifluoromethyl)cyclopropyl]butanamide (PubChem CID 176873148) has the molecular formula C9H14F3NO and a molecular weight of 209.21 g/mol. Its IUPAC name is 3-methyl-N-[1-(trifluoromethyl)cyclopropyl]butanamide.
| Compound Name | 3-methyl-N-[1-(trifluoromethyl)cyclopropyl]butanamide |
|---|---|
| PubChem CID | 176873148 |
| Molecular Formula | C9H14F3NO |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 3-methyl-N-[1-(trifluoromethyl)cyclopropyl]butanamide |
| SMILES | CC(C)CC(=O)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H14F3NO/c1-6(2)5-7(14)13-8(3-4-8)9(10,11)12/h6H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | RAPCRPCKNYOLCJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |