C8H13F3N2O — CID 106213402
2-(ethylamino)-N-[1-(trifluoromethyl)cyclopropyl]acetamide (PubChem CID 106213402) has the molecular formula C8H13F3N2O and a molecular weight of 210.20 g/mol. Its IUPAC name is 2-(ethylamino)-N-[1-(trifluoromethyl)cyclopropyl]acetamide.
| Compound Name | 2-(ethylamino)-N-[1-(trifluoromethyl)cyclopropyl]acetamide |
|---|---|
| PubChem CID | 106213402 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-(ethylamino)-N-[1-(trifluoromethyl)cyclopropyl]acetamide |
| SMILES | CCNCC(=O)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H13F3N2O/c1-2-12-5-6(14)13-7(3-4-7)8(9,10)11/h12H,2-5H2,1H3,(H,13,14) |
| InChIKey | LZZZKRAQYJXAPA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |