C7H13F2N3O3 — CID 106176747
N-carbamoyl-2-[(2,2-difluoro-3-hydroxypropyl)amino]propanamide (PubChem CID 106176747) has the molecular formula C7H13F2N3O3 and a molecular weight of 225.19 g/mol. Its IUPAC name is N-carbamoyl-2-[(2,2-difluoro-3-hydroxypropyl)amino]propanamide.
| Compound Name | N-carbamoyl-2-[(2,2-difluoro-3-hydroxypropyl)amino]propanamide |
|---|---|
| PubChem CID | 106176747 |
| Molecular Formula | C7H13F2N3O3 |
| Molecular Weight | 225.19 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | N-carbamoyl-2-[(2,2-difluoro-3-hydroxypropyl)amino]propanamide |
| SMILES | CC(NCC(F)(F)CO)C(=O)NC(N)=O |
| InChI | InChI=1S/C7H13F2N3O3/c1-4(5(14)12-6(10)15)11-2-7(8,9)3-13/h4,11,13H,2-3H2,1H3,(H3,10,12,14,15) |
| InChIKey | IPHGETFYYBKKTJ-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.19 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |