C21H28N2O6 — CID 10621239
(2S,3R,4R,5S)-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]oxane-3,4-diol (PubChem CID 10621239) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is (2S,3R,4R,5S)-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]oxane-3,4-diol.
| Compound Name | (2S,3R,4R,5S)-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 10621239 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (2S,3R,4R,5S)-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]oxane-3,4-diol |
| SMILES | C[C@H]([C@@H]1O[C@H]1C[C@H]1CO[C@@H](Cc2nnc(-c3ccccc3)o2)[C@H](O)[C@@H]1O)[C@H](C)O |
| InChI | InChI=1S/C21H28N2O6/c1-11(12(2)24)20-16(28-20)8-14-10-27-15(19(26)18(14)25)9-17-22-23-21(29-17)13-6-4-3-5-7-13/h3-7,11-12,14-16,18-20,24-26H,8-10H2,1-2H3/t11-,12-,14-,15-,16-,18+,19-,20-/m0/s1 |
| InChIKey | QJMNHMDXWLXDFS-UBPFNZRSSA-N |
| XLogP | 1.19 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|