C12H9Cl2F3N2 — CID 106216922
6-chloro-2-(chloromethyl)-1-[1-(trifluoromethyl)cyclopropyl]benzimidazole (PubChem CID 106216922) has the molecular formula C12H9Cl2F3N2 and a molecular weight of 309.12 g/mol. Its IUPAC name is 6-chloro-2-(chloromethyl)-1-[1-(trifluoromethyl)cyclopropyl]benzimidazole.
| Compound Name | 6-chloro-2-(chloromethyl)-1-[1-(trifluoromethyl)cyclopropyl]benzimidazole |
|---|---|
| PubChem CID | 106216922 |
| Molecular Formula | C12H9Cl2F3N2 |
| Molecular Weight | 309.12 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 6-chloro-2-(chloromethyl)-1-[1-(trifluoromethyl)cyclopropyl]benzimidazole |
| SMILES | FC(F)(F)C1(n2c(CCl)nc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C12H9Cl2F3N2/c13-6-10-18-8-2-1-7(14)5-9(8)19(10)11(3-4-11)12(15,16)17/h1-2,5H,3-4,6H2 |
| InChIKey | FNNNCRDZUFMCSB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.12 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|