C12H13F3N4O — CID 106217128
4-(difluoromethoxy)-5-fluoro-2-N-[1-(1H-pyrazol-4-yl)ethyl]benzene-1,2-diamine (PubChem CID 106217128) has the molecular formula C12H13F3N4O and a molecular weight of 286.26 g/mol. Its IUPAC name is 4-(difluoromethoxy)-5-fluoro-2-N-[1-(1H-pyrazol-4-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 4-(difluoromethoxy)-5-fluoro-2-N-[1-(1H-pyrazol-4-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 106217128 |
| Molecular Formula | C12H13F3N4O |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-(difluoromethoxy)-5-fluoro-2-N-[1-(1H-pyrazol-4-yl)ethyl]benzene-1,2-diamine |
| SMILES | CC(Nc1cc(OC(F)F)c(F)cc1N)c1cn[nH]c1 |
| InChI | InChI=1S/C12H13F3N4O/c1-6(7-4-17-18-5-7)19-10-3-11(20-12(14)15)8(13)2-9(10)16/h2-6,12,19H,16H2,1H3,(H,17,18) |
| InChIKey | NFCSCRWMLGUPMO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|