C11H12F3N3O — CID 106218163
2-(methylamino)-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-carboxamide (PubChem CID 106218163) has the molecular formula C11H12F3N3O and a molecular weight of 259.23 g/mol. Its IUPAC name is 2-(methylamino)-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-carboxamide.
| Compound Name | 2-(methylamino)-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 106218163 |
| Molecular Formula | C11H12F3N3O |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-(methylamino)-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-carboxamide |
| SMILES | CNc1ncccc1C(=O)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H12F3N3O/c1-15-8-7(3-2-6-16-8)9(18)17-10(4-5-10)11(12,13)14/h2-3,6H,4-5H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | POASDORUTMRJKE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |