C11H17N5O2S — CID 106218637
5-(methylaminomethyl)-N-[1-(1H-pyrazol-4-yl)ethyl]-1H-pyrrole-3-sulfonamide (PubChem CID 106218637) has the molecular formula C11H17N5O2S and a molecular weight of 283.36 g/mol. Its IUPAC name is 5-(methylaminomethyl)-N-[1-(1H-pyrazol-4-yl)ethyl]-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(methylaminomethyl)-N-[1-(1H-pyrazol-4-yl)ethyl]-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106218637 |
| Molecular Formula | C11H17N5O2S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 5-(methylaminomethyl)-N-[1-(1H-pyrazol-4-yl)ethyl]-1H-pyrrole-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NC(C)c2cn[nH]c2)c[nH]1 |
| InChI | InChI=1S/C11H17N5O2S/c1-8(9-4-14-15-5-9)16-19(17,18)11-3-10(6-12-2)13-7-11/h3-5,7-8,12-13,16H,6H2,1-2H3,(H,14,15) |
| InChIKey | KVPLBWJDQNAJOA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |