C13H23F3N2 — CID 106219112
N-[[1-(aminomethyl)-4-methylcyclohexyl]methyl]-1-(trifluoromethyl)cyclopropan-1-amine (PubChem CID 106219112) has the molecular formula C13H23F3N2 and a molecular weight of 264.33 g/mol. Its IUPAC name is N-[[1-(aminomethyl)-4-methylcyclohexyl]methyl]-1-(trifluoromethyl)cyclopropan-1-amine.
| Compound Name | N-[[1-(aminomethyl)-4-methylcyclohexyl]methyl]-1-(trifluoromethyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 106219112 |
| Molecular Formula | C13H23F3N2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N-[[1-(aminomethyl)-4-methylcyclohexyl]methyl]-1-(trifluoromethyl)cyclopropan-1-amine |
| SMILES | CC1CCC(CN)(CNC2(C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C13H23F3N2/c1-10-2-4-11(8-17,5-3-10)9-18-12(6-7-12)13(14,15)16/h10,18H,2-9,17H2,1H3 |
| InChIKey | AQAILKVQBNTQJO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |