About [1-(3,3-dimethylbutyl)-4-methylcyclohexyl]methanamine
[1-(3,3-dimethylbutyl)-4-methylcyclohexyl]methanamine (PubChem CID 65392807) has the molecular formula C14H29N
and a molecular weight of 211.39 g/mol. Its IUPAC name is [1-(3,3-dimethylbutyl)-4-methylcyclohexyl]methanamine.
Analyze [1-(3,3-dimethylbutyl)-4-methylcyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,3-dimethylbutyl)-4-methylcyclohexyl]methanamine?
The IUPAC name of [1-(3,3-dimethylbutyl)-4-methylcyclohexyl]methanamine (CID 65392807) is [1-(3,3-dimethylbutyl)-4-methylcyclohexyl]methanamine.
What is the SMILES notation for [1-(3,3-dimethylbutyl)-4-methylcyclohexyl]methanamine?
The canonical SMILES for [1-(3,3-dimethylbutyl)-4-methylcyclohexyl]methanamine is CC1CCC(CN)(CCC(C)(C)C)CC1.
What is the InChIKey of [1-(3,3-dimethylbutyl)-4-methylcyclohexyl]methanamine?
The InChIKey is KZWSPUIZZARPTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N/c1-12-5-7-14(11-15,8-6-12)10-9-13(2,3)4/h12H,5-11,15H2,1-4H3.
What are the key properties of [1-(3,3-dimethylbutyl)-4-methylcyclohexyl]methanamine?
[1-(3,3-dimethylbutyl)-4-methylcyclohexyl]methanamine has a molecular weight of 211.39 g/mol, XLogP of 3.97, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,3-dimethylbutyl)-4-methylcyclohexyl]methanamine is sourced from PubChem (CID 65392807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).