C11H20N2 — CID 106220280
1-N-pent-4-ynylcyclohexane-1,3-diamine (PubChem CID 106220280) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-N-pent-4-ynylcyclohexane-1,3-diamine.
| Compound Name | 1-N-pent-4-ynylcyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 106220280 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-N-pent-4-ynylcyclohexane-1,3-diamine |
| SMILES | C#CCCCNC1CCCC(N)C1 |
| InChI | InChI=1S/C11H20N2/c1-2-3-4-8-13-11-7-5-6-10(12)9-11/h1,10-11,13H,3-9,12H2 |
| InChIKey | XZVYIOBGDVQXFJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|