C13H15NO2 — CID 106222657
2-[(pent-4-ynylamino)methyl]benzoic acid (PubChem CID 106222657) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-[(pent-4-ynylamino)methyl]benzoic acid.
| Compound Name | 2-[(pent-4-ynylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 106222657 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-[(pent-4-ynylamino)methyl]benzoic acid |
| SMILES | C#CCCCNCc1ccccc1C(=O)O |
| InChI | InChI=1S/C13H15NO2/c1-2-3-6-9-14-10-11-7-4-5-8-12(11)13(15)16/h1,4-5,7-8,14H,3,6,9-10H2,(H,15,16) |
| InChIKey | XABGXRYXHGNHEE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|