C12H13F3N2O — CID 106223250
N-pent-4-ynyl-1-(2,2,2-trifluoroethyl)pyrrole-2-carboxamide (PubChem CID 106223250) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is N-pent-4-ynyl-1-(2,2,2-trifluoroethyl)pyrrole-2-carboxamide.
| Compound Name | N-pent-4-ynyl-1-(2,2,2-trifluoroethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 106223250 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-pent-4-ynyl-1-(2,2,2-trifluoroethyl)pyrrole-2-carboxamide |
| SMILES | C#CCCCNC(=O)c1cccn1CC(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O/c1-2-3-4-7-16-11(18)10-6-5-8-17(10)9-12(13,14)15/h1,5-6,8H,3-4,7,9H2,(H,16,18) |
| InChIKey | ZQDIWLKAQOBQKB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|