C12H17F3N2O2 — CID 106120552
N-(4-hydroxypentyl)-1-(2,2,2-trifluoroethyl)pyrrole-2-carboxamide (PubChem CID 106120552) has the molecular formula C12H17F3N2O2 and a molecular weight of 278.27 g/mol. Its IUPAC name is N-(4-hydroxypentyl)-1-(2,2,2-trifluoroethyl)pyrrole-2-carboxamide.
| Compound Name | N-(4-hydroxypentyl)-1-(2,2,2-trifluoroethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 106120552 |
| Molecular Formula | C12H17F3N2O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-(4-hydroxypentyl)-1-(2,2,2-trifluoroethyl)pyrrole-2-carboxamide |
| SMILES | CC(O)CCCNC(=O)c1cccn1CC(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O2/c1-9(18)4-2-6-16-11(19)10-5-3-7-17(10)8-12(13,14)15/h3,5,7,9,18H,2,4,6,8H2,1H3,(H,16,19) |
| InChIKey | HCWLOIOXTKYPMQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|