C14H18N2O — CID 106223446
2-(4-aminophenyl)-N-hex-1-yn-3-ylacetamide (PubChem CID 106223446) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-hex-1-yn-3-ylacetamide.
| Compound Name | 2-(4-aminophenyl)-N-hex-1-yn-3-ylacetamide |
|---|---|
| PubChem CID | 106223446 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2-(4-aminophenyl)-N-hex-1-yn-3-ylacetamide |
| SMILES | C#CC(CCC)NC(=O)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C14H18N2O/c1-3-5-13(4-2)16-14(17)10-11-6-8-12(15)9-7-11/h2,6-9,13H,3,5,10,15H2,1H3,(H,16,17) |
| InChIKey | ULHRCRKNIQVSCL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|