C13H24N2 — CID 106223603
1-hex-1-yn-3-yl-N,3-dimethylpiperidin-4-amine (PubChem CID 106223603) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 1-hex-1-yn-3-yl-N,3-dimethylpiperidin-4-amine.
| Compound Name | 1-hex-1-yn-3-yl-N,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 106223603 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1-hex-1-yn-3-yl-N,3-dimethylpiperidin-4-amine |
| SMILES | C#CC(CCC)N1CCC(NC)C(C)C1 |
| InChI | InChI=1S/C13H24N2/c1-5-7-12(6-2)15-9-8-13(14-4)11(3)10-15/h2,11-14H,5,7-10H2,1,3-4H3 |
| InChIKey | IKDYEGCGVRNBKW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|