C16H30N2 — CID 106224498
5-butan-2-yl-1-pent-1-yn-3-yl-2-propan-2-ylpiperazine (PubChem CID 106224498) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 5-butan-2-yl-1-pent-1-yn-3-yl-2-propan-2-ylpiperazine.
| Compound Name | 5-butan-2-yl-1-pent-1-yn-3-yl-2-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 106224498 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 5-butan-2-yl-1-pent-1-yn-3-yl-2-propan-2-ylpiperazine |
| SMILES | C#CC(CC)N1CC(C(C)CC)NCC1C(C)C |
| InChI | InChI=1S/C16H30N2/c1-7-13(6)15-11-18(14(8-2)9-3)16(10-17-15)12(4)5/h2,12-17H,7,9-11H2,1,3-6H3 |
| InChIKey | BKWKFBVKKLNUSW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|