C15H17N3 — CID 106225141
N-[(1-phenylpyrazol-3-yl)methyl]pent-1-yn-3-amine (PubChem CID 106225141) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is N-[(1-phenylpyrazol-3-yl)methyl]pent-1-yn-3-amine.
| Compound Name | N-[(1-phenylpyrazol-3-yl)methyl]pent-1-yn-3-amine |
|---|---|
| PubChem CID | 106225141 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-[(1-phenylpyrazol-3-yl)methyl]pent-1-yn-3-amine |
| SMILES | C#CC(CC)NCc1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H17N3/c1-3-13(4-2)16-12-14-10-11-18(17-14)15-8-6-5-7-9-15/h1,5-11,13,16H,4,12H2,2H3 |
| InChIKey | LIGPKCWMUPUCPM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|