C18H32N2O2 — CID 106226159
tert-butyl 2-[2-(hex-1-yn-3-ylamino)propyl]pyrrolidine-1-carboxylate (PubChem CID 106226159) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is tert-butyl 2-[2-(hex-1-yn-3-ylamino)propyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(hex-1-yn-3-ylamino)propyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 106226159 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | tert-butyl 2-[2-(hex-1-yn-3-ylamino)propyl]pyrrolidine-1-carboxylate |
| SMILES | C#CC(CCC)NC(C)CC1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32N2O2/c1-7-10-15(8-2)19-14(3)13-16-11-9-12-20(16)17(21)22-18(4,5)6/h2,14-16,19H,7,9-13H2,1,3-6H3 |
| InChIKey | PKTBPMQCYJCEJL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|