C13H16ClNO — CID 106227360
3-chloro-2-[(hex-1-yn-3-ylamino)methyl]phenol (PubChem CID 106227360) has the molecular formula C13H16ClNO and a molecular weight of 237.73 g/mol. Its IUPAC name is 3-chloro-2-[(hex-1-yn-3-ylamino)methyl]phenol.
| Compound Name | 3-chloro-2-[(hex-1-yn-3-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 106227360 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 3-chloro-2-[(hex-1-yn-3-ylamino)methyl]phenol |
| SMILES | C#CC(CCC)NCc1c(O)cccc1Cl |
| InChI | InChI=1S/C13H16ClNO/c1-3-6-10(4-2)15-9-11-12(14)7-5-8-13(11)16/h2,5,7-8,10,15-16H,3,6,9H2,1H3 |
| InChIKey | JLVVKPKOUZHERQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|