C13H15ClFN — CID 107234203
N-[(2-chloro-4-fluorophenyl)methyl]hex-1-yn-3-amine (PubChem CID 107234203) has the molecular formula C13H15ClFN and a molecular weight of 239.72 g/mol. Its IUPAC name is N-[(2-chloro-4-fluorophenyl)methyl]hex-1-yn-3-amine.
| Compound Name | N-[(2-chloro-4-fluorophenyl)methyl]hex-1-yn-3-amine |
|---|---|
| PubChem CID | 107234203 |
| Molecular Formula | C13H15ClFN |
| Molecular Weight | 239.72 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | N-[(2-chloro-4-fluorophenyl)methyl]hex-1-yn-3-amine |
| SMILES | C#CC(CCC)NCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H15ClFN/c1-3-5-12(4-2)16-9-10-6-7-11(15)8-13(10)14/h2,6-8,12,16H,3,5,9H2,1H3 |
| InChIKey | CAWMGKNQBUFVEZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.72 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|