C12H14FNO — CID 106225386
4-fluoro-2-[(pent-1-yn-3-ylamino)methyl]phenol (PubChem CID 106225386) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is 4-fluoro-2-[(pent-1-yn-3-ylamino)methyl]phenol.
| Compound Name | 4-fluoro-2-[(pent-1-yn-3-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 106225386 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 4-fluoro-2-[(pent-1-yn-3-ylamino)methyl]phenol |
| SMILES | C#CC(CC)NCc1cc(F)ccc1O |
| InChI | InChI=1S/C12H14FNO/c1-3-11(4-2)14-8-9-7-10(13)5-6-12(9)15/h1,5-7,11,14-15H,4,8H2,2H3 |
| InChIKey | CHXRHQGNZORSDW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|