C13H15F2N — CID 106227080
N-[(2,5-difluorophenyl)methyl]hex-1-yn-3-amine (PubChem CID 106227080) has the molecular formula C13H15F2N and a molecular weight of 223.27 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]hex-1-yn-3-amine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]hex-1-yn-3-amine |
|---|---|
| PubChem CID | 106227080 |
| Molecular Formula | C13H15F2N |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]hex-1-yn-3-amine |
| SMILES | C#CC(CCC)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C13H15F2N/c1-3-5-12(4-2)16-9-10-8-11(14)6-7-13(10)15/h2,6-8,12,16H,3,5,9H2,1H3 |
| InChIKey | YQQDJOCOBZWCGO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|