C12H19ClN6 — CID 106227837
1-[1-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]triazol-4-yl]propan-1-amine (PubChem CID 106227837) has the molecular formula C12H19ClN6 and a molecular weight of 282.78 g/mol. Its IUPAC name is 1-[1-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]triazol-4-yl]propan-1-amine.
| Compound Name | 1-[1-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]triazol-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 106227837 |
| Molecular Formula | C12H19ClN6 |
| Molecular Weight | 282.78 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1-[1-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]triazol-4-yl]propan-1-amine |
| SMILES | CCC(N)c1cn(Cc2c(Cl)c(C)nn2CC)nn1 |
| InChI | InChI=1S/C12H19ClN6/c1-4-9(14)10-6-18(17-15-10)7-11-12(13)8(3)16-19(11)5-2/h6,9H,4-5,7,14H2,1-3H3 |
| InChIKey | FTEVJTYHRVCWJV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.78 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |