C12H14ClFN4 — CID 114161084
1-[1-[(4-chloro-3-fluorophenyl)methyl]triazol-4-yl]propan-1-amine (PubChem CID 114161084) has the molecular formula C12H14ClFN4 and a molecular weight of 268.72 g/mol. Its IUPAC name is 1-[1-[(4-chloro-3-fluorophenyl)methyl]triazol-4-yl]propan-1-amine.
| Compound Name | 1-[1-[(4-chloro-3-fluorophenyl)methyl]triazol-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 114161084 |
| Molecular Formula | C12H14ClFN4 |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 1-[1-[(4-chloro-3-fluorophenyl)methyl]triazol-4-yl]propan-1-amine |
| SMILES | CCC(N)c1cn(Cc2ccc(Cl)c(F)c2)nn1 |
| InChI | InChI=1S/C12H14ClFN4/c1-2-11(15)12-7-18(17-16-12)6-8-3-4-9(13)10(14)5-8/h3-5,7,11H,2,6,15H2,1H3 |
| InChIKey | CHMWNSNJQQLVCH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |