C13H25N5O — CID 106228683
2-[4-(1-aminobutyl)triazol-1-yl]-N-(2-methylbutan-2-yl)acetamide (PubChem CID 106228683) has the molecular formula C13H25N5O and a molecular weight of 267.38 g/mol. Its IUPAC name is 2-[4-(1-aminobutyl)triazol-1-yl]-N-(2-methylbutan-2-yl)acetamide.
| Compound Name | 2-[4-(1-aminobutyl)triazol-1-yl]-N-(2-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 106228683 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | 2-[4-(1-aminobutyl)triazol-1-yl]-N-(2-methylbutan-2-yl)acetamide |
| SMILES | CCCC(N)c1cn(CC(=O)NC(C)(C)CC)nn1 |
| InChI | InChI=1S/C13H25N5O/c1-5-7-10(14)11-8-18(17-16-11)9-12(19)15-13(3,4)6-2/h8,10H,5-7,9,14H2,1-4H3,(H,15,19) |
| InChIKey | XAEVEEPCZRNAAS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |